| LB | Lactobacilli |
|---|
| lactobacilli | Plural of lactobacillus. (05 Mar 2000) |
|---|---|
| lactobacillic acid | CH3(CH2)4CH2-CH-CH-(CH2)9COOH; (1R-cis)-2-hexycyclopropanedecanoic acid;a major constituent of the lipids of lactobacilli; notable for the presence of a cyclopropane ring in the molecule. (05 Mar 2000) |
| lactobacilli |
Lactobacillus is a genus of Gram-positive facultative bacteria, named as such because most of its members convert lactose and other simple sugars to lactic acid. They are common and usually benign -- indeed, necessary -- inhabitants of the bodies of humans and other animals - for example, they are present in the gastrointestinal tract and the vagina. Many species are prominent in decaying plant material. ...
출처: en.wikipedia.org/wiki/Lactobacilli
|
|---|
제품명 |
판매사 |
보험코드 | 성분/함량 | 구분/보험급여 |
|---|
제품명 |
판매사 |
보험코드 | 성분/함량 | 구분/보험급여 |
|---|