| 영문 | lactose | 한글 | 젖당 |
|---|---|---|---|
| 설명 | 포도당 1몰과 갈락토오스 1몰로 이루어지는 이당류의 하나. 분자식 C22H22O11, 분자량 342.29. 유당이라고도 한다. 무색결정으로서 약간의 단맛이 있다. 우유 속에는 약 4.5%, 인유 속에는 약 7% 함유되어 있다. 환원기의 입체배치의 차에 의해 α형과 β형이 있으며, 20℃에서는 약 37.3% 대 62.7%의 비율로 존재한다. 이 상태의 락토오스를 평형락토오스라고 한다. 어린이의 영양제로 쓴다. |
||
| lacto-N-biosidase | <enzyme> Hydrolyzes oligosaccharides containing a type 1 structure at the nonreducing terminus and produces lacto-n-biose (gal beta1-3glcnac) Registry number: EC 3.2.1.- (26 Jun 1999) |
|---|---|
| lacto-ovo-vegetarian | A vegetarian who consumes dairy products and eggs but does not eat animal flesh. (05 Mar 2000) |
| lactoabumin | <physiology> The albumin present on milk, apparently identical with ordinary serum albumin. It is distinct from the casein of milk. Origin: L. Lac, lactis, milk + E. Albumin. Source: Websters Dictionary (01 Mar 1998) |
| lactobacillaceae | A family of gram-positive bacteria found regularly in the mouth and intestinal tract of man and other animals, in food and dairy products, and in fermenting vegetable juices. A few species are highly pathogenic. (12 Dec 1998) |
| lactobacillary milk | Milk inoculated with a culture of Bacillus acidophilus, B. Bulgaricus, or other lactic acid-forming microorganism. (05 Mar 2000) |
| lactobacilli | Plural of lactobacillus. (05 Mar 2000) |
| lactobacillic acid | CH3(CH2)4CH2-CH-CH-(CH2)9COOH; (1R-cis)-2-hexycyclopropanedecanoic acid;a major constituent of the lipids of lactobacilli; notable for the presence of a cyclopropane ring in the molecule. (05 Mar 2000) |
| lactobacillus | Literally milk bacteria, normally found in the mouth, intestinal tract and vagina. (12 Dec 1998) |
| lactobacillus acidophilus | Bug that produces acidophilus milk. (12 Dec 1998) |
| Lactobacillus bifidus | Former name for Bifidobacterium bifidum. (05 Mar 2000) |
| Lactobacillus bifidus pennsylvanicus | Former name for Bifidobacterium bifidum. (05 Mar 2000) |
| Lactobacillus brevis | A species widely distributed in nature, especially in plant and animal products; it is also found in the mouth and intestinal tract of humans and rats. (05 Mar 2000) |
| Lactobacillus buchneri | A species widely distributed in fermenting substances. (05 Mar 2000) |
| Lactobacillus bulgaricus | A species used in the production of yogurt. (05 Mar 2000) |
| Lactobacillus bulgaricus factor | <chemical> 2,4-dihydroxy-n-[2-[(2-merceptoethyl)carbamoyl]ethyl]-3,3-dimethylbutyramide. An intermediate in the pathway of coenzyme a formation in mammalian liver and some microorganisms. Chemical name: Butanamide, 2,4-dihydroxy-N-(3-((2-mercaptoethyl)amino)-3-oxopropyl)-3,3-dimethyl-, (R)- (12 Dec 1998) |
Synonyms :
Synonyms :
Synonyms : Lactobacillus amylovorus
Synonyms :
Synonyms :
제품명 |
판매사 |
보험코드 | 성분/함량 | 구분/보험급여 |
|---|---|---|---|---|
|
앤디락캅셀 - 새창
|
일양약품 |
A09550611 | Lactobacillus acidophillus, Lactobacillus bifidus, Streptococcus faecalis | 일반의약품 | 삭제 |
|
락토메드정 - 새창
|
일동제약 |
A03402761 | Lactobacillus acidophillus, Lactobacillus bifidus, Streptococcus faecalis | 일반의약품 | 삭제 |
|
앤디락산 - 새창
|
일양약품 |
A09500651 | Lactobacillus acidophillus, Lactobacillus bifidus, Streptococcus faecalis | 일반의약품 | 삭제 |
|
안티비오캅셀 - 새창
|
한화제약 |
A15300101 | Lactobacillus acidophillus | 일반의약품 | 급여 |
|
아시토바캅셀 - 새창
|
대한뉴팜 |
A60650291 | Lactobacillus acidophillus | 일반의약품 | 급여 |
|
비오락틴캡슐 - 새창
|
명인제약 |
A09250841 | Lactobacillus acidophillus tyndalized lyophilized | 일반의약품 | 급여 |
|
동화락테올캅셀 - 새창
|
동화약품공업 |
A05703061 | Lactobacillus acidophillus tyndalized lyophilized | 일반의약품 | 급여 |
|
락시틴캅셀 - 새창
|
한올제약 |
A03550131 | Lactobacillus acidophillus tyndalized lyophilized | 일반의약품 | 급여 |
|
코로민캅셀 - 새창
|
제이알피 |
A09050091 | Lactobacillus acidophillus tyndalized lyophilized | 일반의약품 | 급여 |
|
락톨캅셀 - 새창
|
진양제약 |
A10750241 | Lactobacillus acidophillus tyndalized lyophilized | 일반의약품 | 급여 |
| lactoflavin |
vitamin B2: a B vitamin that prevents skin lesions and weight loss
출처: wordnet.princeton.edu/perl/webwn
|
|---|---|
| lactogenic hormone |
prolactin: gonadotropic hormone secreted by the anterior pituitary; in females it stimulates growth of the mammary glands and lactation after parturition
출처: wordnet.princeton.edu/perl/webwn
|
| Lactobacillus |
Gram-positive rod-shaped bacteria that produce lactic acid especially in milk
출처: wordnet.princeton.edu/perl/webwn
|
| lactogen |
any agent that enhances milk production
출처: wordnet.princeton.edu/perl/webwn
|
| lactogenic |
inducing lactation
출처: wordnet.princeton.edu/perl/webwn
|
| lacto | lactic acid bacteria and important pathogens |
|---|---|
| lacto | gram-positive rod-shaped bacteria that produce lactic acid especially in milk |
| lacto | lactic acid bacteria and important pathogens |
| lacto | a B vitamin that prevents skin lesions and weight loss |
| lacto | any agent that enhances milk production |
| lacto | inducing lactation |
| lacto | gonadotropic hormone secreted by the anterior pituitary |
| lacto | a genus of Ostraciidae |
| lacto | trunkfish having hornlike spines over the eyes |
| lacto | a sugar comprising one glucose molecule linked to a galactose molecule |
| lacto | congenital disorder consisting of an inability to digest milk and milk products |
| lacto | presence of lactose in the urine |
제품명 |
판매사 |
보험코드 | 성분/함량 | 구분/보험급여 |
|---|
